C18H24BNO4 — CID 178183334
tert-butyl 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)indole-1-carboxylate (PubChem CID 178183334) has the molecular formula C18H24BNO4 and a molecular weight of 329.21 g/mol. Its IUPAC name is tert-butyl 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 178183334 |
| Molecular Formula | C18H24BNO4 |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | tert-butyl 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)indole-1-carboxylate |
| SMILES | CC1(C)COB(c2cc3ccccc3n2C(=O)OC(C)(C)C)OC1 |
| InChI | InChI=1S/C18H24BNO4/c1-17(2,3)24-16(21)20-14-9-7-6-8-13(14)10-15(20)19-22-11-18(4,5)12-23-19/h6-10H,11-12H2,1-5H3 |
| InChIKey | UCIWAFQEYTYYQB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|