C20H25BO4 — CID 122374191
tert-butyl 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)naphthalene-1-carboxylate (PubChem CID 122374191) has the molecular formula C20H25BO4 and a molecular weight of 340.23 g/mol. Its IUPAC name is tert-butyl 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)naphthalene-1-carboxylate.
| Compound Name | tert-butyl 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 122374191 |
| Molecular Formula | C20H25BO4 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | tert-butyl 6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)naphthalene-1-carboxylate |
| SMILES | CC1(C)COB(c2ccc3c(C(=O)OC(C)(C)C)cccc3c2)OC1 |
| InChI | InChI=1S/C20H25BO4/c1-19(2,3)25-18(22)17-8-6-7-14-11-15(9-10-16(14)17)21-23-12-20(4,5)13-24-21/h6-11H,12-13H2,1-5H3 |
| InChIKey | MDETXNJMWRJVAU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|