C16H19O5P — CID 10990879
[8-[(2-methylpropan-2-yl)oxycarbonyl]naphthalen-2-yl]methylphosphonic acid (PubChem CID 10990879) has the molecular formula C16H19O5P and a molecular weight of 322.30 g/mol. Its IUPAC name is [8-[(2-methylpropan-2-yl)oxycarbonyl]naphthalen-2-yl]methylphosphonic acid.
| Compound Name | [8-[(2-methylpropan-2-yl)oxycarbonyl]naphthalen-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 10990879 |
| Molecular Formula | C16H19O5P |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [8-[(2-methylpropan-2-yl)oxycarbonyl]naphthalen-2-yl]methylphosphonic acid |
| SMILES | CC(C)(C)OC(=O)c1cccc2ccc(CP(=O)(O)O)cc12 |
| InChI | InChI=1S/C16H19O5P/c1-16(2,3)21-15(17)13-6-4-5-12-8-7-11(9-14(12)13)10-22(18,19)20/h4-9H,10H2,1-3H3,(H2,18,19,20) |
| InChIKey | GJONRBYSDNSSFP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|