C18H23O4PS — CID 87973237
tert-butyl 7-[[hydroxy(methoxymethyl)phosphinothioyl]methyl]naphthalene-1-carboxylate (PubChem CID 87973237) has the molecular formula C18H23O4PS and a molecular weight of 366.42 g/mol. Its IUPAC name is tert-butyl 7-[[hydroxy(methoxymethyl)phosphinothioyl]methyl]naphthalene-1-carboxylate.
| Compound Name | tert-butyl 7-[[hydroxy(methoxymethyl)phosphinothioyl]methyl]naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 87973237 |
| Molecular Formula | C18H23O4PS |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | tert-butyl 7-[[hydroxy(methoxymethyl)phosphinothioyl]methyl]naphthalene-1-carboxylate |
| SMILES | COCP(O)(=S)Cc1ccc2cccc(C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C18H23O4PS/c1-18(2,3)22-17(19)15-7-5-6-14-9-8-13(10-16(14)15)11-23(20,24)12-21-4/h5-10H,11-12H2,1-4H3,(H,20,24) |
| InChIKey | WNUOXDNBZDFHEI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|