C17H26BNO4 — CID 132539877
tert-butyl N-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-N-methylcarbamate (PubChem CID 132539877) has the molecular formula C17H26BNO4 and a molecular weight of 319.21 g/mol. Its IUPAC name is tert-butyl N-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 132539877 |
| Molecular Formula | C17H26BNO4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl N-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(B2OCC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C17H26BNO4/c1-16(2,3)23-15(20)19(6)14-9-7-13(8-10-14)18-21-11-17(4,5)12-22-18/h7-10H,11-12H2,1-6H3 |
| InChIKey | KJABCICJNUOMCA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|