C18H19BO3 — CID 135072391
[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-phenylmethanone (PubChem CID 135072391) has the molecular formula C18H19BO3 and a molecular weight of 294.16 g/mol. Its IUPAC name is [4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-phenylmethanone.
| Compound Name | [4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 135072391 |
| Molecular Formula | C18H19BO3 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-phenylmethanone |
| SMILES | CC1(C)COB(c2ccc(C(=O)c3ccccc3)cc2)OC1 |
| InChI | InChI=1S/C18H19BO3/c1-18(2)12-21-19(22-13-18)16-10-8-15(9-11-16)17(20)14-6-4-3-5-7-14/h3-11H,12-13H2,1-2H3 |
| InChIKey | YFKGHOZRSGFUTF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|