C21H22BrNO2 — CID 19762643
tert-butyl 2-[(4-bromophenyl)methyl]-5-methylindole-1-carboxylate (PubChem CID 19762643) has the molecular formula C21H22BrNO2 and a molecular weight of 400.32 g/mol. Its IUPAC name is tert-butyl 2-[(4-bromophenyl)methyl]-5-methylindole-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-bromophenyl)methyl]-5-methylindole-1-carboxylate |
|---|---|
| PubChem CID | 19762643 |
| Molecular Formula | C21H22BrNO2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | tert-butyl 2-[(4-bromophenyl)methyl]-5-methylindole-1-carboxylate |
| SMILES | Cc1ccc2c(c1)cc(Cc1ccc(Br)cc1)n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H22BrNO2/c1-14-5-10-19-16(11-14)13-18(12-15-6-8-17(22)9-7-15)23(19)20(24)25-21(2,3)4/h5-11,13H,12H2,1-4H3 |
| InChIKey | HWBYAVGZFWZIII-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |