C23H25FN2O4 — CID 11517180
tert-butyl 2-[[4-[acetyl(methyl)amino]phenoxy]methyl]-6-fluoroindole-1-carboxylate (PubChem CID 11517180) has the molecular formula C23H25FN2O4 and a molecular weight of 412.46 g/mol. Its IUPAC name is tert-butyl 2-[[4-[acetyl(methyl)amino]phenoxy]methyl]-6-fluoroindole-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-[acetyl(methyl)amino]phenoxy]methyl]-6-fluoroindole-1-carboxylate |
|---|---|
| PubChem CID | 11517180 |
| Molecular Formula | C23H25FN2O4 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | tert-butyl 2-[[4-[acetyl(methyl)amino]phenoxy]methyl]-6-fluoroindole-1-carboxylate |
| SMILES | CC(=O)N(C)c1ccc(OCc2cc3ccc(F)cc3n2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H25FN2O4/c1-15(27)25(5)18-8-10-20(11-9-18)29-14-19-12-16-6-7-17(24)13-21(16)26(19)22(28)30-23(2,3)4/h6-13H,14H2,1-5H3 |
| InChIKey | BXNFUUUVBGSCTJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |