C30H37Br2N3O7 — CID 158253903
5-bromo-1H-isoindole;tert-butyl 5-bromoindazole-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (PubChem CID 158253903) has the molecular formula C30H37Br2N3O7 and a molecular weight of 711.45 g/mol. Its IUPAC name is 5-bromo-1H-isoindole;tert-butyl 5-bromoindazole-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate.
| Compound Name | 5-bromo-1H-isoindole;tert-butyl 5-bromoindazole-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
|---|---|
| PubChem CID | 158253903 |
| Molecular Formula | C30H37Br2N3O7 |
| Molecular Weight | 711.45 g/mol |
| Exact Mass | 709.10 |
| IUPAC Name | 5-bromo-1H-isoindole;tert-butyl 5-bromoindazole-1-carboxylate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| SMILES | Brc1ccc2c(c1)C=NC2.CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)(C)OC(=O)n1ncc2cc(Br)ccc21 |
| InChI | InChI=1S/C12H13BrN2O2.C10H18O5.C8H6BrN/c1-12(2,3)17-11(16)15-10-5-4-9(13)6-8(10)7-14-15;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;9-8-2-1-6-4-10-5-7(6)3-8/h4-7H,1-3H3;1-6H3;1-3,5H,4H2 |
| InChIKey | GHATVKSFXQZDPS-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 118.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.45 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|