C20H20F3N3O2 — CID 167300444
2-methyl-6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-1,2-benzoxazol-3-one (PubChem CID 167300444) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-methyl-6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-1,2-benzoxazol-3-one.
| Compound Name | 2-methyl-6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-1,2-benzoxazol-3-one |
|---|---|
| PubChem CID | 167300444 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-methyl-6-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-1,2-benzoxazol-3-one |
| SMILES | Cn1oc2cc(Nc3ccc(N4CCC(C(F)(F)F)CC4)cc3)ccc2c1=O |
| InChI | InChI=1S/C20H20F3N3O2/c1-25-19(27)17-7-4-15(12-18(17)28-25)24-14-2-5-16(6-3-14)26-10-8-13(9-11-26)20(21,22)23/h2-7,12-13,24H,8-11H2,1H3 |
| InChIKey | AUMUQTHDELWXBU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|