C18H19F3N2 — CID 166061952
N-phenyl-4-[4-(trifluoromethyl)piperidin-1-yl]aniline (PubChem CID 166061952) has the molecular formula C18H19F3N2 and a molecular weight of 320.36 g/mol. Its IUPAC name is N-phenyl-4-[4-(trifluoromethyl)piperidin-1-yl]aniline.
| Compound Name | N-phenyl-4-[4-(trifluoromethyl)piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 166061952 |
| Molecular Formula | C18H19F3N2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-phenyl-4-[4-(trifluoromethyl)piperidin-1-yl]aniline |
| SMILES | FC(F)(F)C1CCN(c2ccc(Nc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C18H19F3N2/c19-18(20,21)14-10-12-23(13-11-14)17-8-6-16(7-9-17)22-15-4-2-1-3-5-15/h1-9,14,22H,10-13H2 |
| InChIKey | SVLVZXKURYHNCI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|