C27H26F3N3O — CID 167300255
2-benzyl-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-3H-isoindol-1-one (PubChem CID 167300255) has the molecular formula C27H26F3N3O and a molecular weight of 465.52 g/mol. Its IUPAC name is 2-benzyl-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-3H-isoindol-1-one.
| Compound Name | 2-benzyl-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 167300255 |
| Molecular Formula | C27H26F3N3O |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 2-benzyl-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-3H-isoindol-1-one |
| SMILES | O=C1c2ccc(Nc3ccc(N4CCC(C(F)(F)F)CC4)cc3)cc2CN1Cc1ccccc1 |
| InChI | InChI=1S/C27H26F3N3O/c28-27(29,30)21-12-14-32(15-13-21)24-9-6-22(7-10-24)31-23-8-11-25-20(16-23)18-33(26(25)34)17-19-4-2-1-3-5-19/h1-11,16,21,31H,12-15,17-18H2 |
| InChIKey | LXCIKOFITZONQY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|