C21H26N4O — CID 167300552
1,2-dimethyl-6-[4-(4-methylpiperidin-1-yl)anilino]indazol-3-one (PubChem CID 167300552) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 1,2-dimethyl-6-[4-(4-methylpiperidin-1-yl)anilino]indazol-3-one.
| Compound Name | 1,2-dimethyl-6-[4-(4-methylpiperidin-1-yl)anilino]indazol-3-one |
|---|---|
| PubChem CID | 167300552 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 1,2-dimethyl-6-[4-(4-methylpiperidin-1-yl)anilino]indazol-3-one |
| SMILES | CC1CCN(c2ccc(Nc3ccc4c(=O)n(C)n(C)c4c3)cc2)CC1 |
| InChI | InChI=1S/C21H26N4O/c1-15-10-12-25(13-11-15)18-7-4-16(5-8-18)22-17-6-9-19-20(14-17)23(2)24(3)21(19)26/h4-9,14-15,22H,10-13H2,1-3H3 |
| InChIKey | FBODSGCORJAEER-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|