C20H22F3N3O2 — CID 175555992
1-[3-methyl-4-(2,3,4,5-tetrahydro-1,5-benzoxazepin-8-ylamino)phenyl]-3-(trifluoromethyl)azetidin-3-ol (PubChem CID 175555992) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 1-[3-methyl-4-(2,3,4,5-tetrahydro-1,5-benzoxazepin-8-ylamino)phenyl]-3-(trifluoromethyl)azetidin-3-ol.
| Compound Name | 1-[3-methyl-4-(2,3,4,5-tetrahydro-1,5-benzoxazepin-8-ylamino)phenyl]-3-(trifluoromethyl)azetidin-3-ol |
|---|---|
| PubChem CID | 175555992 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-[3-methyl-4-(2,3,4,5-tetrahydro-1,5-benzoxazepin-8-ylamino)phenyl]-3-(trifluoromethyl)azetidin-3-ol |
| SMILES | Cc1cc(N2CC(O)(C(F)(F)F)C2)ccc1Nc1ccc2c(c1)OCCCN2 |
| InChI | InChI=1S/C20H22F3N3O2/c1-13-9-15(26-11-19(27,12-26)20(21,22)23)4-6-16(13)25-14-3-5-17-18(10-14)28-8-2-7-24-17/h3-6,9-10,24-25,27H,2,7-8,11-12H2,1H3 |
| InChIKey | IHCZWBNRZISDHX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|