C11H17N3O — CID 142373636
2,3,4,5,6,7-hexahydro-1H-8,1,4-benzoxadiazecin-10-amine (PubChem CID 142373636) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexahydro-1H-8,1,4-benzoxadiazecin-10-amine.
| Compound Name | 2,3,4,5,6,7-hexahydro-1H-8,1,4-benzoxadiazecin-10-amine |
|---|---|
| PubChem CID | 142373636 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2,3,4,5,6,7-hexahydro-1H-8,1,4-benzoxadiazecin-10-amine |
| SMILES | Nc1ccc2c(c1)OCCCNCCN2 |
| InChI | InChI=1S/C11H17N3O/c12-9-2-3-10-11(8-9)15-7-1-4-13-5-6-14-10/h2-3,8,13-14H,1,4-7,12H2 |
| InChIKey | PVAFQFGHORFPCK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|