C24H30N6OS2 — CID 158162839
3,4-dihydro-2H-1,4-benzothiazin-6-amine;3,4-dihydro-2H-1,4-benzothiazin-7-amine;3,4-dihydro-2H-1,4-benzoxazin-7-amine (PubChem CID 158162839) has the molecular formula C24H30N6OS2 and a molecular weight of 482.68 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,4-benzothiazin-6-amine;3,4-dihydro-2H-1,4-benzothiazin-7-amine;3,4-dihydro-2H-1,4-benzoxazin-7-amine.
| Compound Name | 3,4-dihydro-2H-1,4-benzothiazin-6-amine;3,4-dihydro-2H-1,4-benzothiazin-7-amine;3,4-dihydro-2H-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 158162839 |
| Molecular Formula | C24H30N6OS2 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 3,4-dihydro-2H-1,4-benzothiazin-6-amine;3,4-dihydro-2H-1,4-benzothiazin-7-amine;3,4-dihydro-2H-1,4-benzoxazin-7-amine |
| SMILES | Nc1ccc2c(c1)NCCS2.Nc1ccc2c(c1)OCCN2.Nc1ccc2c(c1)SCCN2 |
| InChI | InChI=1S/C8H10N2O.2C8H10N2S/c9-6-1-2-7-8(5-6)11-4-3-10-7;9-6-1-2-8-7(5-6)10-3-4-11-8;9-6-1-2-7-8(5-6)11-4-3-10-7/h3*1-2,5,10H,3-4,9H2 |
| InChIKey | FWMHXTHMKIYXJR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|