C9H9NOS — CID 116998957
3,4-dihydro-2H-1,4-benzothiazine-7-carbaldehyde (PubChem CID 116998957) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,4-benzothiazine-7-carbaldehyde.
| Compound Name | 3,4-dihydro-2H-1,4-benzothiazine-7-carbaldehyde |
|---|---|
| PubChem CID | 116998957 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 3,4-dihydro-2H-1,4-benzothiazine-7-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)SCCN2 |
| InChI | InChI=1S/C9H9NOS/c11-6-7-1-2-8-9(5-7)12-4-3-10-8/h1-2,5-6,10H,3-4H2 |
| InChIKey | BYFLGRFMFODPRV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|