C14H20N2S — CID 116998930
7-(piperidin-2-ylmethyl)-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 116998930) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 7-(piperidin-2-ylmethyl)-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | 7-(piperidin-2-ylmethyl)-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 116998930 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 7-(piperidin-2-ylmethyl)-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | c1cc2c(cc1CC1CCCCN1)SCCN2 |
| InChI | InChI=1S/C14H20N2S/c1-2-6-15-12(3-1)9-11-4-5-13-14(10-11)17-8-7-16-13/h4-5,10,12,15-16H,1-3,6-9H2 |
| InChIKey | DOVXOLDTHYUAFN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |