C12H15NOS — CID 117316958
2-(1,3-benzoxathiol-6-ylmethyl)pyrrolidine (PubChem CID 117316958) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 2-(1,3-benzoxathiol-6-ylmethyl)pyrrolidine.
| Compound Name | 2-(1,3-benzoxathiol-6-ylmethyl)pyrrolidine |
|---|---|
| PubChem CID | 117316958 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-(1,3-benzoxathiol-6-ylmethyl)pyrrolidine |
| SMILES | c1cc2c(cc1CC1CCCN1)OCS2 |
| InChI | InChI=1S/C12H15NOS/c1-2-10(13-5-1)6-9-3-4-12-11(7-9)14-8-15-12/h3-4,7,10,13H,1-2,5-6,8H2 |
| InChIKey | VTZAYQHTHOVAKE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |