C14H15F4NO2 — CID 117490561
2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methyl]piperidine (PubChem CID 117490561) has the molecular formula C14H15F4NO2 and a molecular weight of 305.27 g/mol. Its IUPAC name is 2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methyl]piperidine.
| Compound Name | 2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methyl]piperidine |
|---|---|
| PubChem CID | 117490561 |
| Molecular Formula | C14H15F4NO2 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methyl]piperidine |
| SMILES | FC1(F)Oc2ccc(CC3CCCCN3)cc2OC1(F)F |
| InChI | InChI=1S/C14H15F4NO2/c15-13(16)14(17,18)21-12-8-9(4-5-11(12)20-13)7-10-3-1-2-6-19-10/h4-5,8,10,19H,1-3,6-7H2 |
| InChIKey | IBMOPXMGYLTFDS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|