C13H16F2N2O2 — CID 106632861
2,2-difluoro-N-(piperidin-2-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 106632861) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2,2-difluoro-N-(piperidin-2-ylmethyl)-1,3-benzodioxol-5-amine.
| Compound Name | 2,2-difluoro-N-(piperidin-2-ylmethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 106632861 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2,2-difluoro-N-(piperidin-2-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | FC1(F)Oc2ccc(NCC3CCCCN3)cc2O1 |
| InChI | InChI=1S/C13H16F2N2O2/c14-13(15)18-11-5-4-9(7-12(11)19-13)17-8-10-3-1-2-6-16-10/h4-5,7,10,16-17H,1-3,6,8H2 |
| InChIKey | WIUARINUOWGZOY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|