C13H14F2N2O3 — CID 61371585
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-pyrrolidin-2-ylacetamide (PubChem CID 61371585) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 61371585 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-pyrrolidin-2-ylacetamide |
| SMILES | O=C(CC1CCCN1)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C13H14F2N2O3/c14-13(15)19-10-4-3-9(6-11(10)20-13)17-12(18)7-8-2-1-5-16-8/h3-4,6,8,16H,1-2,5,7H2,(H,17,18) |
| InChIKey | SWKIKUJFAPONLX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |