C9H9NO2S — CID 11389961
3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid (PubChem CID 11389961) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid.
| Compound Name | 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid |
|---|---|
| PubChem CID | 11389961 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)SCCN2 |
| InChI | InChI=1S/C9H9NO2S/c11-9(12)6-1-2-7-8(5-6)13-4-3-10-7/h1-2,5,10H,3-4H2,(H,11,12) |
| InChIKey | SQBFMDTYGSMTHZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |