3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid

C9H9NO2S — CID 11389961

IUPAC3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)SCCN2
InChIInChI=1S/C9H9NO2S/c11-9(12)6-1-2-7-8(5-6)13-4-3-10-7/h1-2,5,10H,3-4H2,(H,11,12)
InChIKeySQBFMDTYGSMTHZ-UHFFFAOYSA-N
MW195.24 g/mol
LogP1.90
Rot. Bonds1

About 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid

3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid (PubChem CID 11389961) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid.

Molecular Properties

Compound Name3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid
PubChem CID11389961
Molecular FormulaC9H9NO2S
Molecular Weight195.24 g/mol
Exact Mass195.04
IUPAC Name3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)SCCN2
InChIInChI=1S/C9H9NO2S/c11-9(12)6-1-2-7-8(5-6)13-4-3-10-7/h1-2,5,10H,3-4H2,(H,11,12)
InChIKeySQBFMDTYGSMTHZ-UHFFFAOYSA-N
XLogP1.90
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.24
LogP ≤ 51.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid?
The IUPAC name of 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid (CID 11389961) is 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid.
What is the SMILES notation for 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid?
The canonical SMILES for 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid is O=C(O)c1ccc2c(c1)SCCN2.
What is the InChIKey of 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid?
The InChIKey is SQBFMDTYGSMTHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c11-9(12)6-1-2-7-8(5-6)13-4-3-10-7/h1-2,5,10H,3-4H2,(H,11,12).
What are the key properties of 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid?
3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid has a molecular weight of 195.24 g/mol, XLogP of 1.90, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid is sourced from PubChem (CID 11389961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).