3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid

C11H13NO2S — CID 115096230

IUPAC3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid
SMILESCC1(C)CSc2cc(C(=O)O)ccc2N1
InChIInChI=1S/C11H13NO2S/c1-11(2)6-15-9-5-7(10(13)14)3-4-8(9)12-11/h3-5,12H,6H2,1-2H3,(H,13,14)
InChIKeyXIAYQRRXHDLUED-UHFFFAOYSA-N
MW223.30 g/mol
LogP2.68
Rot. Bonds1

About 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid

3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid (PubChem CID 115096230) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid.

Molecular Properties

Compound Name3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid
PubChem CID115096230
Molecular FormulaC11H13NO2S
Molecular Weight223.30 g/mol
Exact Mass223.07
IUPAC Name3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid
SMILESCC1(C)CSc2cc(C(=O)O)ccc2N1
InChIInChI=1S/C11H13NO2S/c1-11(2)6-15-9-5-7(10(13)14)3-4-8(9)12-11/h3-5,12H,6H2,1-2H3,(H,13,14)
InChIKeyXIAYQRRXHDLUED-UHFFFAOYSA-N
XLogP2.68
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.30
LogP ≤ 52.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid?
The IUPAC name of 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid (CID 115096230) is 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid.
What is the SMILES notation for 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid?
The canonical SMILES for 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid is CC1(C)CSc2cc(C(=O)O)ccc2N1.
What is the InChIKey of 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid?
The InChIKey is XIAYQRRXHDLUED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2S/c1-11(2)6-15-9-5-7(10(13)14)3-4-8(9)12-11/h3-5,12H,6H2,1-2H3,(H,13,14).
What are the key properties of 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid?
3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid has a molecular weight of 223.30 g/mol, XLogP of 2.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2,4-dihydro-1,4-benzothiazine-7-carboxylic acid is sourced from PubChem (CID 115096230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).