8,9-dichloro-10H-phenothiazine-3-carboxylic acid

C13H7Cl2NO2S — CID 10018387

IUPAC8,9-dichloro-10H-phenothiazine-3-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)Sc1ccc(Cl)c(Cl)c1N2
InChIInChI=1S/C13H7Cl2NO2S/c14-7-2-4-9-12(11(7)15)16-8-3-1-6(13(17)18)5-10(8)19-9/h1-5,16H,(H,17,18)
InChIKeyRJEYAFZGLRMZEG-UHFFFAOYSA-N
MW312.18 g/mol
LogP4.90
Rot. Bonds1

About 8,9-dichloro-10H-phenothiazine-3-carboxylic acid

8,9-dichloro-10H-phenothiazine-3-carboxylic acid (PubChem CID 10018387) has the molecular formula C13H7Cl2NO2S and a molecular weight of 312.18 g/mol. Its IUPAC name is 8,9-dichloro-10H-phenothiazine-3-carboxylic acid.

Molecular Properties

Compound Name8,9-dichloro-10H-phenothiazine-3-carboxylic acid
PubChem CID10018387
Molecular FormulaC13H7Cl2NO2S
Molecular Weight312.18 g/mol
Exact Mass310.96
IUPAC Name8,9-dichloro-10H-phenothiazine-3-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)Sc1ccc(Cl)c(Cl)c1N2
InChIInChI=1S/C13H7Cl2NO2S/c14-7-2-4-9-12(11(7)15)16-8-3-1-6(13(17)18)5-10(8)19-9/h1-5,16H,(H,17,18)
InChIKeyRJEYAFZGLRMZEG-UHFFFAOYSA-N
XLogP4.90
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.18
LogP ≤ 54.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 8,9-dichloro-10H-phenothiazine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8,9-dichloro-10H-phenothiazine-3-carboxylic acid?
The IUPAC name of 8,9-dichloro-10H-phenothiazine-3-carboxylic acid (CID 10018387) is 8,9-dichloro-10H-phenothiazine-3-carboxylic acid.
What is the SMILES notation for 8,9-dichloro-10H-phenothiazine-3-carboxylic acid?
The canonical SMILES for 8,9-dichloro-10H-phenothiazine-3-carboxylic acid is O=C(O)c1ccc2c(c1)Sc1ccc(Cl)c(Cl)c1N2.
What is the InChIKey of 8,9-dichloro-10H-phenothiazine-3-carboxylic acid?
The InChIKey is RJEYAFZGLRMZEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl2NO2S/c14-7-2-4-9-12(11(7)15)16-8-3-1-6(13(17)18)5-10(8)19-9/h1-5,16H,(H,17,18).
What are the key properties of 8,9-dichloro-10H-phenothiazine-3-carboxylic acid?
8,9-dichloro-10H-phenothiazine-3-carboxylic acid has a molecular weight of 312.18 g/mol, XLogP of 4.90, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dichloro-10H-phenothiazine-3-carboxylic acid is sourced from PubChem (CID 10018387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).