About 4-chloro-3-fluorobenzoic acid
4-chloro-3-fluorobenzoic acid (PubChem CID 2736536) has the molecular formula C7H4ClFO2
and a molecular weight of 174.56 g/mol. Its IUPAC name is 4-chloro-3-fluorobenzoic acid.
Molecular Properties
| Compound Name | 4-chloro-3-fluorobenzoic acid |
| PubChem CID | 2736536 |
| Molecular Formula | C7H4ClFO2 |
| Molecular Weight | 174.56 g/mol |
| Exact Mass | 173.99 |
| IUPAC Name | 4-chloro-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C7H4ClFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) |
| InChIKey | QPIBHIXKUQKNFP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.56 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-3-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-fluorobenzoic acid?
The IUPAC name of 4-chloro-3-fluorobenzoic acid (CID 2736536) is 4-chloro-3-fluorobenzoic acid.
What is the SMILES notation for 4-chloro-3-fluorobenzoic acid?
The canonical SMILES for 4-chloro-3-fluorobenzoic acid is O=C(O)c1ccc(Cl)c(F)c1.
What is the InChIKey of 4-chloro-3-fluorobenzoic acid?
The InChIKey is QPIBHIXKUQKNFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11).
What are the key properties of 4-chloro-3-fluorobenzoic acid?
4-chloro-3-fluorobenzoic acid has a molecular weight of 174.56 g/mol, XLogP of 2.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-fluorobenzoic acid is sourced from PubChem (CID 2736536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).