C13H4Cl5FO2 — CID 134620174
3-fluoro-4-(2,3,4,5,6-pentachlorophenyl)benzoic acid (PubChem CID 134620174) has the molecular formula C13H4Cl5FO2 and a molecular weight of 388.44 g/mol. Its IUPAC name is 3-fluoro-4-(2,3,4,5,6-pentachlorophenyl)benzoic acid.
| Compound Name | 3-fluoro-4-(2,3,4,5,6-pentachlorophenyl)benzoic acid |
|---|---|
| PubChem CID | 134620174 |
| Molecular Formula | C13H4Cl5FO2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 385.86 |
| IUPAC Name | 3-fluoro-4-(2,3,4,5,6-pentachlorophenyl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(F)c1 |
| InChI | InChI=1S/C13H4Cl5FO2/c14-8-7(9(15)11(17)12(18)10(8)16)5-2-1-4(13(20)21)3-6(5)19/h1-3H,(H,20,21) |
| InChIKey | VYNFYNNCAOYEJF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|