C15H12F2O2 — CID 106879243
3-fluoro-4-(4-fluoro-2,6-dimethylphenyl)benzoic acid (PubChem CID 106879243) has the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. Its IUPAC name is 3-fluoro-4-(4-fluoro-2,6-dimethylphenyl)benzoic acid.
| Compound Name | 3-fluoro-4-(4-fluoro-2,6-dimethylphenyl)benzoic acid |
|---|---|
| PubChem CID | 106879243 |
| Molecular Formula | C15H12F2O2 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-fluoro-4-(4-fluoro-2,6-dimethylphenyl)benzoic acid |
| SMILES | Cc1cc(F)cc(C)c1-c1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C15H12F2O2/c1-8-5-11(16)6-9(2)14(8)12-4-3-10(15(18)19)7-13(12)17/h3-7H,1-2H3,(H,18,19) |
| InChIKey | YLLCBFHRTUQWOZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |