C15H6F2O4 — CID 135305382
5,8-difluoro-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 135305382) has the molecular formula C15H6F2O4 and a molecular weight of 288.20 g/mol. Its IUPAC name is 5,8-difluoro-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 5,8-difluoro-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 135305382 |
| Molecular Formula | C15H6F2O4 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 5,8-difluoro-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)c1c(F)ccc(F)c1C2=O |
| InChI | InChI=1S/C15H6F2O4/c16-9-3-4-10(17)12-11(9)13(18)7-2-1-6(15(20)21)5-8(7)14(12)19/h1-5H,(H,20,21) |
| InChIKey | VVVJTDVXIMBTKT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|