C15H10O4 — CID 144801520
9,10-dioxo-6,7-dihydroanthracene-2-carboxylic acid (PubChem CID 144801520) has the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. Its IUPAC name is 9,10-dioxo-6,7-dihydroanthracene-2-carboxylic acid.
| Compound Name | 9,10-dioxo-6,7-dihydroanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 144801520 |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 9,10-dioxo-6,7-dihydroanthracene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)C1=CCCC=C1C2=O |
| InChI | InChI=1S/C15H10O4/c16-13-9-3-1-2-4-10(9)14(17)12-7-8(15(18)19)5-6-11(12)13/h3-7H,1-2H2,(H,18,19) |
| InChIKey | LYXPUHKIUHYUSR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |