C17H14O3 — CID 58406938
8-(2-hydroxyphenyl)-5,6-dihydronaphthalene-2-carboxylic acid (PubChem CID 58406938) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 8-(2-hydroxyphenyl)-5,6-dihydronaphthalene-2-carboxylic acid.
| Compound Name | 8-(2-hydroxyphenyl)-5,6-dihydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 58406938 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 8-(2-hydroxyphenyl)-5,6-dihydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(c1ccccc1O)=CCC2 |
| InChI | InChI=1S/C17H14O3/c18-16-7-2-1-5-14(16)13-6-3-4-11-8-9-12(17(19)20)10-15(11)13/h1-2,5-10,18H,3-4H2,(H,19,20) |
| InChIKey | IRRRWCFLMVZYNZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |