C18H13NO2 — CID 58407546
8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid (PubChem CID 58407546) has the molecular formula C18H13NO2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid.
| Compound Name | 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 58407546 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid |
| SMILES | [C-]#[N+]c1cccc(C2=CCCc3ccc(C(=O)O)cc32)c1 |
| InChI | InChI=1S/C18H13NO2/c1-19-15-6-2-5-13(10-15)16-7-3-4-12-8-9-14(18(20)21)11-17(12)16/h2,5-11H,3-4H2,(H,20,21) |
| InChIKey | SNAPPSVDRIRDGI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|