About 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid
8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid (PubChem CID 58407546) has the molecular formula C18H13NO2
and a molecular weight of 275.31 g/mol. Its IUPAC name is 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid |
| PubChem CID | 58407546 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid |
| SMILES | [C-]#[N+]c1cccc(C2=CCCc3ccc(C(=O)O)cc32)c1 |
| InChI | InChI=1S/C18H13NO2/c1-19-15-6-2-5-13(10-15)16-7-3-4-12-8-9-14(18(20)21)11-17(12)16/h2,5-11H,3-4H2,(H,20,21) |
| InChIKey | SNAPPSVDRIRDGI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid?
The IUPAC name of 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid (CID 58407546) is 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid.
What is the SMILES notation for 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid?
The canonical SMILES for 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid is [C-]#[N+]c1cccc(C2=CCCc3ccc(C(=O)O)cc32)c1.
What is the InChIKey of 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid?
The InChIKey is SNAPPSVDRIRDGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO2/c1-19-15-6-2-5-13(10-15)16-7-3-4-12-8-9-14(18(20)21)11-17(12)16/h2,5-11H,3-4H2,(H,20,21).
What are the key properties of 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid?
8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid has a molecular weight of 275.31 g/mol, XLogP of 4.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-isocyanophenyl)-5,6-dihydronaphthalene-2-carboxylic acid is sourced from PubChem (CID 58407546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).