About 3-isocyanobenzoic acid
3-isocyanobenzoic acid (PubChem CID 20667055) has the molecular formula C8H5NO2
and a molecular weight of 147.13 g/mol. Its IUPAC name is 3-isocyanobenzoic acid.
Molecular Properties
| Compound Name | 3-isocyanobenzoic acid |
| PubChem CID | 20667055 |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | 3-isocyanobenzoic acid |
| SMILES | [C-]#[N+]c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H5NO2/c1-9-7-4-2-3-6(5-7)8(10)11/h2-5H,(H,10,11) |
| InChIKey | QAMXRSYGKZAIDC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyanobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyanobenzoic acid?
The IUPAC name of 3-isocyanobenzoic acid (CID 20667055) is 3-isocyanobenzoic acid.
What is the SMILES notation for 3-isocyanobenzoic acid?
The canonical SMILES for 3-isocyanobenzoic acid is [C-]#[N+]c1cccc(C(=O)O)c1.
What is the InChIKey of 3-isocyanobenzoic acid?
The InChIKey is QAMXRSYGKZAIDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2/c1-9-7-4-2-3-6(5-7)8(10)11/h2-5H,(H,10,11).
What are the key properties of 3-isocyanobenzoic acid?
3-isocyanobenzoic acid has a molecular weight of 147.13 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyanobenzoic acid is sourced from PubChem (CID 20667055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).