C17H9FO4 — CID 155555177
(2Z)-2-[(4-fluorophenyl)methylidene]-1,3-dioxoindene-5-carboxylic acid (PubChem CID 155555177) has the molecular formula C17H9FO4 and a molecular weight of 296.25 g/mol. Its IUPAC name is (2Z)-2-[(4-fluorophenyl)methylidene]-1,3-dioxoindene-5-carboxylic acid.
| Compound Name | (2Z)-2-[(4-fluorophenyl)methylidene]-1,3-dioxoindene-5-carboxylic acid |
|---|---|
| PubChem CID | 155555177 |
| Molecular Formula | C17H9FO4 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (2Z)-2-[(4-fluorophenyl)methylidene]-1,3-dioxoindene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)/C(=C\c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C17H9FO4/c18-11-4-1-9(2-5-11)7-14-15(19)12-6-3-10(17(21)22)8-13(12)16(14)20/h1-8H,(H,21,22)/b14-7- |
| InChIKey | KNXFCODEBNFLNL-AUWJEWJLSA-N |
| XLogP | 2.99 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|