C23H14F2O — CID 2387034
(1Z,3Z)-1,3-bis[(4-fluorophenyl)methylidene]inden-2-one (PubChem CID 2387034) has the molecular formula C23H14F2O and a molecular weight of 344.36 g/mol. Its IUPAC name is (1Z,3Z)-1,3-bis[(4-fluorophenyl)methylidene]inden-2-one.
| Compound Name | (1Z,3Z)-1,3-bis[(4-fluorophenyl)methylidene]inden-2-one |
|---|---|
| PubChem CID | 2387034 |
| Molecular Formula | C23H14F2O |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (1Z,3Z)-1,3-bis[(4-fluorophenyl)methylidene]inden-2-one |
| SMILES | O=C1/C(=C\c2ccc(F)cc2)c2ccccc2/C1=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C23H14F2O/c24-17-9-5-15(6-10-17)13-21-19-3-1-2-4-20(19)22(23(21)26)14-16-7-11-18(25)12-8-16/h1-14H/b21-13-,22-14- |
| InChIKey | KYXLZZSYWPELOU-JZTLMNBPSA-N |
| XLogP | 5.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|