C25H22OSi — CID 24858896
(1E,3Z)-1-benzylidene-3-[[dimethyl(phenyl)silyl]methylidene]inden-2-one (PubChem CID 24858896) has the molecular formula C25H22OSi and a molecular weight of 366.54 g/mol. Its IUPAC name is (1E,3Z)-1-benzylidene-3-[[dimethyl(phenyl)silyl]methylidene]inden-2-one.
| Compound Name | (1E,3Z)-1-benzylidene-3-[[dimethyl(phenyl)silyl]methylidene]inden-2-one |
|---|---|
| PubChem CID | 24858896 |
| Molecular Formula | C25H22OSi |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (1E,3Z)-1-benzylidene-3-[[dimethyl(phenyl)silyl]methylidene]inden-2-one |
| SMILES | C[Si](C)(/C=C1\C(=O)/C(=C/c2ccccc2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C25H22OSi/c1-27(2,20-13-7-4-8-14-20)18-24-22-16-10-9-15-21(22)23(25(24)26)17-19-11-5-3-6-12-19/h3-18H,1-2H3/b23-17+,24-18- |
| InChIKey | JSNVDLHUWSZXJB-QEYUTVSCSA-N |
| XLogP | 5.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|