C26H30Si2 — CID 101344758
[4-[dimethyl-[(Z)-2-phenylethenyl]silyl]phenyl]-dimethyl-[(Z)-2-phenylethenyl]silane (PubChem CID 101344758) has the molecular formula C26H30Si2 and a molecular weight of 398.70 g/mol. Its IUPAC name is [4-[dimethyl-[(Z)-2-phenylethenyl]silyl]phenyl]-dimethyl-[(Z)-2-phenylethenyl]silane.
| Compound Name | [4-[dimethyl-[(Z)-2-phenylethenyl]silyl]phenyl]-dimethyl-[(Z)-2-phenylethenyl]silane |
|---|---|
| PubChem CID | 101344758 |
| Molecular Formula | C26H30Si2 |
| Molecular Weight | 398.70 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [4-[dimethyl-[(Z)-2-phenylethenyl]silyl]phenyl]-dimethyl-[(Z)-2-phenylethenyl]silane |
| SMILES | C[Si](C)(/C=C\c1ccccc1)c1ccc([Si](C)(C)/C=C\c2ccccc2)cc1 |
| InChI | InChI=1S/C26H30Si2/c1-27(2,21-19-23-11-7-5-8-12-23)25-15-17-26(18-16-25)28(3,4)22-20-24-13-9-6-10-14-24/h5-22H,1-4H3/b21-19-,22-20- |
| InChIKey | HNQZRVJTOOGNQS-WRBBJXAJSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|