C24H34Si2 — CID 102085704
(4-tert-butylphenyl)-[(1Z,3E)-4-[dimethyl(phenyl)silyl]buta-1,3-dienyl]-dimethylsilane (PubChem CID 102085704) has the molecular formula C24H34Si2 and a molecular weight of 378.71 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[(1Z,3E)-4-[dimethyl(phenyl)silyl]buta-1,3-dienyl]-dimethylsilane.
| Compound Name | (4-tert-butylphenyl)-[(1Z,3E)-4-[dimethyl(phenyl)silyl]buta-1,3-dienyl]-dimethylsilane |
|---|---|
| PubChem CID | 102085704 |
| Molecular Formula | C24H34Si2 |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (4-tert-butylphenyl)-[(1Z,3E)-4-[dimethyl(phenyl)silyl]buta-1,3-dienyl]-dimethylsilane |
| SMILES | CC(C)(C)c1ccc([Si](C)(C)/C=C\C=C\[Si](C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H34Si2/c1-24(2,3)21-15-17-23(18-16-21)26(6,7)20-12-11-19-25(4,5)22-13-9-8-10-14-22/h8-20H,1-7H3/b19-11+,20-12- |
| InChIKey | MVOQZWIBJXOSBQ-ZZUVKVOASA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|