C12H16Si — CID 11263945
[(1E)-buta-1,3-dienyl]-dimethyl-phenylsilane (PubChem CID 11263945) has the molecular formula C12H16Si and a molecular weight of 188.35 g/mol. Its IUPAC name is [(1E)-buta-1,3-dienyl]-dimethyl-phenylsilane.
| Compound Name | [(1E)-buta-1,3-dienyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 11263945 |
| Molecular Formula | C12H16Si |
| Molecular Weight | 188.35 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [(1E)-buta-1,3-dienyl]-dimethyl-phenylsilane |
| SMILES | C=C/C=C/[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C12H16Si/c1-4-5-11-13(2,3)12-9-7-6-8-10-12/h4-11H,1H2,2-3H3/b11-5+ |
| InChIKey | XSVRLXPVIYBULY-VZUCSPMQSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|