C15H20Si — CID 174010632
[(2E,4Z)-hepta-2,4,6-trien-3-yl]-dimethyl-phenylsilane (PubChem CID 174010632) has the molecular formula C15H20Si and a molecular weight of 228.41 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4,6-trien-3-yl]-dimethyl-phenylsilane.
| Compound Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 174010632 |
| Molecular Formula | C15H20Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]-dimethyl-phenylsilane |
| SMILES | C=C/C=C\C(=C/C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H20Si/c1-5-7-11-14(6-2)16(3,4)15-12-9-8-10-13-15/h5-13H,1H2,2-4H3/b11-7-,14-6+ |
| InChIKey | VMOZBSIFZMSBDX-UICNISDOSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|