C20H32Si — CID 101095442
[(3Z)-dodeca-1,3-dien-4-yl]-dimethyl-phenylsilane (PubChem CID 101095442) has the molecular formula C20H32Si and a molecular weight of 300.56 g/mol. Its IUPAC name is [(3Z)-dodeca-1,3-dien-4-yl]-dimethyl-phenylsilane.
| Compound Name | [(3Z)-dodeca-1,3-dien-4-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 101095442 |
| Molecular Formula | C20H32Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | [(3Z)-dodeca-1,3-dien-4-yl]-dimethyl-phenylsilane |
| SMILES | C=C/C=C(/CCCCCCCC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H32Si/c1-5-7-8-9-10-12-16-19(15-6-2)21(3,4)20-17-13-11-14-18-20/h6,11,13-15,17-18H,2,5,7-10,12,16H2,1,3-4H3/b19-15- |
| InChIKey | WCXKFMPNUJGJQH-CYVLTUHYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|