C26H34O2P+ — CID 162757888
[(3E)-hexa-1,3,5-trien-3-yl]-diphenylphosphanium;octanoic acid (PubChem CID 162757888) has the molecular formula C26H34O2P+ and a molecular weight of 409.53 g/mol. Its IUPAC name is [(3E)-hexa-1,3,5-trien-3-yl]-diphenylphosphanium;octanoic acid.
| Compound Name | [(3E)-hexa-1,3,5-trien-3-yl]-diphenylphosphanium;octanoic acid |
|---|---|
| PubChem CID | 162757888 |
| Molecular Formula | C26H34O2P+ |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | [(3E)-hexa-1,3,5-trien-3-yl]-diphenylphosphanium;octanoic acid |
| SMILES | C=C/C=C(\C=C)[PH+](c1ccccc1)c1ccccc1.CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H17P.C8H16O2/c1-3-11-16(4-2)19(17-12-7-5-8-13-17)18-14-9-6-10-15-18;1-2-3-4-5-6-7-8(9)10/h3-15H,1-2H2;2-7H2,1H3,(H,9,10)/p+1/b16-11+; |
| InChIKey | OLXZBADERYVVGC-YFMOEUEHSA-O |
| XLogP | 6.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|