About (Z)-octadec-9-enoic acid;styrene
(Z)-octadec-9-enoic acid;styrene (PubChem CID 169085427) has the molecular formula C26H42O2
and a molecular weight of 386.62 g/mol. Its IUPAC name is (Z)-octadec-9-enoic acid;styrene.
Molecular Properties
| Compound Name | (Z)-octadec-9-enoic acid;styrene |
| PubChem CID | 169085427 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | (Z)-octadec-9-enoic acid;styrene |
| SMILES | C=Cc1ccccc1.CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C8H8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-8-6-4-3-5-7-8/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-7H,1H2/b10-9-; |
| InChIKey | LWQQHSCXBBRYIL-KVVVOXFISA-N |
| XLogP | 8.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-9-enoic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-9-enoic acid;styrene?
The IUPAC name of (Z)-octadec-9-enoic acid;styrene (CID 169085427) is (Z)-octadec-9-enoic acid;styrene.
What is the SMILES notation for (Z)-octadec-9-enoic acid;styrene?
The canonical SMILES for (Z)-octadec-9-enoic acid;styrene is C=Cc1ccccc1.CCCCCCCC/C=C\CCCCCCCC(=O)O.
What is the InChIKey of (Z)-octadec-9-enoic acid;styrene?
The InChIKey is LWQQHSCXBBRYIL-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C8H8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-8-6-4-3-5-7-8/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-7H,1H2/b10-9-;.
What are the key properties of (Z)-octadec-9-enoic acid;styrene?
(Z)-octadec-9-enoic acid;styrene has a molecular weight of 386.62 g/mol, XLogP of 8.44, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-enoic acid;styrene is sourced from PubChem (CID 169085427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).