About formaldehyde;octadec-9-enoic acid
formaldehyde;octadec-9-enoic acid (PubChem CID 159210703) has the molecular formula C19H36O3
and a molecular weight of 312.49 g/mol. Its IUPAC name is formaldehyde;octadec-9-enoic acid.
Molecular Properties
| Compound Name | formaldehyde;octadec-9-enoic acid |
| PubChem CID | 159210703 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | formaldehyde;octadec-9-enoic acid |
| SMILES | C=O.CCCCCCCCC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.CH2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2/h9-10H,2-8,11-17H2,1H3,(H,19,20);1H2 |
| InChIKey | KQLOFTPPBSLSOG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;octadec-9-enoic acid?
The IUPAC name of formaldehyde;octadec-9-enoic acid (CID 159210703) is formaldehyde;octadec-9-enoic acid.
What is the SMILES notation for formaldehyde;octadec-9-enoic acid?
The canonical SMILES for formaldehyde;octadec-9-enoic acid is C=O.CCCCCCCCC=CCCCCCCCC(=O)O.
What is the InChIKey of formaldehyde;octadec-9-enoic acid?
The InChIKey is KQLOFTPPBSLSOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2.CH2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2/h9-10H,2-8,11-17H2,1H3,(H,19,20);1H2.
What are the key properties of formaldehyde;octadec-9-enoic acid?
formaldehyde;octadec-9-enoic acid has a molecular weight of 312.49 g/mol, XLogP of 5.92, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;octadec-9-enoic acid is sourced from PubChem (CID 159210703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).