C18H30OSi — CID 10779898
(E)-4-[dimethyl(phenyl)silyl]dec-3-en-2-ol (PubChem CID 10779898) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is (E)-4-[dimethyl(phenyl)silyl]dec-3-en-2-ol.
| Compound Name | (E)-4-[dimethyl(phenyl)silyl]dec-3-en-2-ol |
|---|---|
| PubChem CID | 10779898 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (E)-4-[dimethyl(phenyl)silyl]dec-3-en-2-ol |
| SMILES | CCCCCC/C(=C\C(C)O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H30OSi/c1-5-6-7-9-14-18(15-16(2)19)20(3,4)17-12-10-8-11-13-17/h8,10-13,15-16,19H,5-7,9,14H2,1-4H3/b18-15+ |
| InChIKey | DKAKIFWVUINUPB-OBGWFSINSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|