C23H32O2SSi — CID 135057520
dimethyl-[(Z)-1-(4-methylphenyl)sulfonyloct-1-en-2-yl]-phenylsilane (PubChem CID 135057520) has the molecular formula C23H32O2SSi and a molecular weight of 400.66 g/mol. Its IUPAC name is dimethyl-[(Z)-1-(4-methylphenyl)sulfonyloct-1-en-2-yl]-phenylsilane.
| Compound Name | dimethyl-[(Z)-1-(4-methylphenyl)sulfonyloct-1-en-2-yl]-phenylsilane |
|---|---|
| PubChem CID | 135057520 |
| Molecular Formula | C23H32O2SSi |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | dimethyl-[(Z)-1-(4-methylphenyl)sulfonyloct-1-en-2-yl]-phenylsilane |
| SMILES | CCCCCC/C(=C/S(=O)(=O)c1ccc(C)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H32O2SSi/c1-5-6-7-9-14-23(27(3,4)22-12-10-8-11-13-22)19-26(24,25)21-17-15-20(2)16-18-21/h8,10-13,15-19H,5-7,9,14H2,1-4H3/b23-19- |
| InChIKey | HXXQXWHFDMIZFY-NMWGTECJSA-N |
| XLogP | 5.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|