C12H14Cl2Si — CID 163444493
dichloro-[(2E,4Z)-hexa-2,4-dien-3-yl]-phenylsilane (PubChem CID 163444493) has the molecular formula C12H14Cl2Si and a molecular weight of 257.24 g/mol. Its IUPAC name is dichloro-[(2E,4Z)-hexa-2,4-dien-3-yl]-phenylsilane.
| Compound Name | dichloro-[(2E,4Z)-hexa-2,4-dien-3-yl]-phenylsilane |
|---|---|
| PubChem CID | 163444493 |
| Molecular Formula | C12H14Cl2Si |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | dichloro-[(2E,4Z)-hexa-2,4-dien-3-yl]-phenylsilane |
| SMILES | C/C=C\C(=C/C)[Si](Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C12H14Cl2Si/c1-3-8-11(4-2)15(13,14)12-9-6-5-7-10-12/h3-10H,1-2H3/b8-3-,11-4+ |
| InChIKey | BBIRPMCNEFDGDY-YMRMPOAWSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|