C10H19ClN4Si — CID 102590424
2-[chloro-(2,2-dimethylhydrazinyl)-phenylsilyl]-1,1-dimethylhydrazine (PubChem CID 102590424) has the molecular formula C10H19ClN4Si and a molecular weight of 258.83 g/mol. Its IUPAC name is 2-[chloro-(2,2-dimethylhydrazinyl)-phenylsilyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[chloro-(2,2-dimethylhydrazinyl)-phenylsilyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 102590424 |
| Molecular Formula | C10H19ClN4Si |
| Molecular Weight | 258.83 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-[chloro-(2,2-dimethylhydrazinyl)-phenylsilyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)N[Si](Cl)(NN(C)C)c1ccccc1 |
| InChI | InChI=1S/C10H19ClN4Si/c1-14(2)12-16(11,13-15(3)4)10-8-6-5-7-9-10/h5-9,12-13H,1-4H3 |
| InChIKey | REBFYQWGGRISFA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.83 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|