C12H22N2Si — CID 15527926
2-[dimethyl(2-phenylethyl)silyl]-1,1-dimethylhydrazine (PubChem CID 15527926) has the molecular formula C12H22N2Si and a molecular weight of 222.41 g/mol. Its IUPAC name is 2-[dimethyl(2-phenylethyl)silyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[dimethyl(2-phenylethyl)silyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 15527926 |
| Molecular Formula | C12H22N2Si |
| Molecular Weight | 222.41 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-[dimethyl(2-phenylethyl)silyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)N[Si](C)(C)CCc1ccccc1 |
| InChI | InChI=1S/C12H22N2Si/c1-14(2)13-15(3,4)11-10-12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3 |
| InChIKey | AENCUDSBXNWWEE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|