C22H36O3Si2 — CID 159040096
trimethoxy(2-phenylethyl)silane;trimethyl(2-phenylethyl)silane (PubChem CID 159040096) has the molecular formula C22H36O3Si2 and a molecular weight of 404.70 g/mol. Its IUPAC name is trimethoxy(2-phenylethyl)silane;trimethyl(2-phenylethyl)silane.
| Compound Name | trimethoxy(2-phenylethyl)silane;trimethyl(2-phenylethyl)silane |
|---|---|
| PubChem CID | 159040096 |
| Molecular Formula | C22H36O3Si2 |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | trimethoxy(2-phenylethyl)silane;trimethyl(2-phenylethyl)silane |
| SMILES | CO[Si](CCc1ccccc1)(OC)OC.C[Si](C)(C)CCc1ccccc1 |
| InChI | InChI=1S/C11H18O3Si.C11H18Si/c1-12-15(13-2,14-3)10-9-11-7-5-4-6-8-11;1-12(2,3)10-9-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3;4-8H,9-10H2,1-3H3 |
| InChIKey | JVYFYOBLJWMEQF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|